C17H13N5O2 — CID 109303579
2-(2-cyanoanilino)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide (PubChem CID 109303579) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-(2-cyanoanilino)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(2-cyanoanilino)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109303579 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-(2-cyanoanilino)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide |
| SMILES | N#Cc1ccccc1Nc1nccc(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C17H13N5O2/c18-10-12-4-1-2-6-14(12)21-17-19-8-7-15(22-17)16(23)20-11-13-5-3-9-24-13/h1-9H,11H2,(H,20,23)(H,19,21,22) |
| InChIKey | RMVOHVASDMPGDO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |