C19H18N4O4 — CID 109303578
ethyl 2-[[4-(furan-2-ylmethylcarbamoyl)pyrimidin-2-yl]amino]benzoate (PubChem CID 109303578) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is ethyl 2-[[4-(furan-2-ylmethylcarbamoyl)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 2-[[4-(furan-2-ylmethylcarbamoyl)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109303578 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | ethyl 2-[[4-(furan-2-ylmethylcarbamoyl)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nccc(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C19H18N4O4/c1-2-26-18(25)14-7-3-4-8-15(14)22-19-20-10-9-16(23-19)17(24)21-12-13-6-5-11-27-13/h3-11H,2,12H2,1H3,(H,21,24)(H,20,22,23) |
| InChIKey | QVORWCFMRZEBBG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |