C34H34O6S — CID 10918833
methyl (2S,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 10918833) has the molecular formula C34H34O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 10918833 |
| Molecular Formula | C34H34O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | methyl (2S,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Sc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H34O6S/c1-36-33(35)31-29(37-22-25-14-6-2-7-15-25)30(38-23-26-16-8-3-9-17-26)32(39-24-27-18-10-4-11-19-27)34(40-31)41-28-20-12-5-13-21-28/h2-21,29-32,34H,22-24H2,1H3/t29-,30+,31+,32-,34+/m1/s1 |
| InChIKey | SKTIDYVTFMNJIC-XXFURDKYSA-N |
| XLogP | 6.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |