C19H14ClF2N3O — CID 109189536
N-(3-chloro-4-fluorophenyl)-5-[(2-fluorophenyl)methylamino]pyridine-2-carboxamide (PubChem CID 109189536) has the molecular formula C19H14ClF2N3O and a molecular weight of 373.79 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-[(2-fluorophenyl)methylamino]pyridine-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-[(2-fluorophenyl)methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109189536 |
| Molecular Formula | C19H14ClF2N3O |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-[(2-fluorophenyl)methylamino]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1ccc(NCc2ccccc2F)cn1 |
| InChI | InChI=1S/C19H14ClF2N3O/c20-15-9-13(5-7-17(15)22)25-19(26)18-8-6-14(11-24-18)23-10-12-3-1-2-4-16(12)21/h1-9,11,23H,10H2,(H,25,26) |
| InChIKey | XGAGQRADBGXOQS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |