C19H16ClFN4O2 — CID 109257939
N-(3-chloro-4-fluorophenyl)-2-[(2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide (PubChem CID 109257939) has the molecular formula C19H16ClFN4O2 and a molecular weight of 386.81 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[(2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[(2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109257939 |
| Molecular Formula | C19H16ClFN4O2 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[(2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide |
| SMILES | COc1ccccc1CNc1ncc(C(=O)Nc2ccc(F)c(Cl)c2)cn1 |
| InChI | InChI=1S/C19H16ClFN4O2/c1-27-17-5-3-2-4-12(17)9-22-19-23-10-13(11-24-19)18(26)25-14-6-7-16(21)15(20)8-14/h2-8,10-11H,9H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | ULEAWKPEMDTAEP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |