C38H42O8 — CID 10919228
ethyl 2-[(2S,3R,4S,5S,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate (PubChem CID 10919228) has the molecular formula C38H42O8 and a molecular weight of 626.75 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,4S,5S,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,4S,5S,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 10919228 |
| Molecular Formula | C38H42O8 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | ethyl 2-[(2S,3R,4S,5S,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@]1(O)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H42O8/c1-2-42-34(39)23-38(40)37(45-27-32-21-13-6-14-22-32)36(44-26-31-19-11-5-12-20-31)35(43-25-30-17-9-4-10-18-30)33(46-38)28-41-24-29-15-7-3-8-16-29/h3-22,33,35-37,40H,2,23-28H2,1H3/t33-,35+,36+,37-,38+/m1/s1 |
| InChIKey | RKTAIJSQIIRFNC-KGJARIPRSA-N |
| XLogP | 6.00 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |