C22H22FN3O2 — CID 109192445
N-(4-ethoxyphenyl)-5-[2-(4-fluorophenyl)ethylamino]pyridine-2-carboxamide (PubChem CID 109192445) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5-[2-(4-fluorophenyl)ethylamino]pyridine-2-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-5-[2-(4-fluorophenyl)ethylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109192445 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-5-[2-(4-fluorophenyl)ethylamino]pyridine-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NCCc3ccc(F)cc3)cn2)cc1 |
| InChI | InChI=1S/C22H22FN3O2/c1-2-28-20-10-7-18(8-11-20)26-22(27)21-12-9-19(15-25-21)24-14-13-16-3-5-17(23)6-4-16/h3-12,15,24H,2,13-14H2,1H3,(H,26,27) |
| InChIKey | CNUCIIZIMJJNHK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |