C35H48O9Si — CID 10919312
[(2S,4aR,6R,7R,8S,8aS)-8-[(2S)-3-cyclohexyl-1-methoxy-1-oxopropan-2-yl]oxy-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 10919312) has the molecular formula C35H48O9Si and a molecular weight of 640.85 g/mol. Its IUPAC name is [(2S,4aR,6R,7R,8S,8aS)-8-[(2S)-3-cyclohexyl-1-methoxy-1-oxopropan-2-yl]oxy-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(2S,4aR,6R,7R,8S,8aS)-8-[(2S)-3-cyclohexyl-1-methoxy-1-oxopropan-2-yl]oxy-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 10919312 |
| Molecular Formula | C35H48O9Si |
| Molecular Weight | 640.85 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | [(2S,4aR,6R,7R,8S,8aS)-8-[(2S)-3-cyclohexyl-1-methoxy-1-oxopropan-2-yl]oxy-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | COC(=O)[C@H](CC1CCCCC1)O[C@H]1[C@H]2O[C@@H](c3ccccc3)OC[C@H]2O[C@@H](OCC[Si](C)(C)C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H48O9Si/c1-38-33(37)27(22-24-14-8-5-9-15-24)41-30-29-28(23-40-34(44-29)26-18-12-7-13-19-26)42-35(39-20-21-45(2,3)4)31(30)43-32(36)25-16-10-6-11-17-25/h6-7,10-13,16-19,24,27-31,34-35H,5,8-9,14-15,20-23H2,1-4H3/t27-,28+,29-,30-,31+,34-,35+/m0/s1 |
| InChIKey | HHHABSGVHICJTC-AOSFYSAWSA-N |
| XLogP | 6.30 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.85 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|