C38H55NO4Si2 — CID 10919344
(3R,4R)-1-benzyl-4-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropyl]-3-phenylmethoxyazetidin-2-one (PubChem CID 10919344) has the molecular formula C38H55NO4Si2 and a molecular weight of 646.03 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropyl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4R)-1-benzyl-4-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropyl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 10919344 |
| Molecular Formula | C38H55NO4Si2 |
| Molecular Weight | 646.03 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | (3R,4R)-1-benzyl-4-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropyl]-3-phenylmethoxyazetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]([C@H]1[C@@H](OCc2ccccc2)C(=O)N1Cc1ccccc1)[C@H](Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H55NO4Si2/c1-37(2,3)44(7,8)42-32(26-29-20-14-11-15-21-29)34(43-45(9,10)38(4,5)6)33-35(41-28-31-24-18-13-19-25-31)36(40)39(33)27-30-22-16-12-17-23-30/h11-25,32-35H,26-28H2,1-10H3/t32-,33-,34+,35+/m0/s1 |
| InChIKey | SKQFSLLPKJSETO-NUXXNWGHSA-N |
| XLogP | 9.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.03 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|