C19H26N6O — CID 109194515
[5-[butyl(methyl)amino]-2-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109194515) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is [5-[butyl(methyl)amino]-2-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-[butyl(methyl)amino]-2-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109194515 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [5-[butyl(methyl)amino]-2-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | CCCCN(C)c1ccc(C(=O)N2CCN(c3ncccn3)CC2)nc1 |
| InChI | InChI=1S/C19H26N6O/c1-3-4-10-23(2)16-6-7-17(22-15-16)18(26)24-11-13-25(14-12-24)19-20-8-5-9-21-19/h5-9,15H,3-4,10-14H2,1-2H3 |
| InChIKey | FDQKKNUNLVFJEZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |