C20H26FN5O — CID 109285588
[5-[butyl(methyl)amino]pyrazin-2-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 109285588) has the molecular formula C20H26FN5O and a molecular weight of 371.46 g/mol. Its IUPAC name is [5-[butyl(methyl)amino]pyrazin-2-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [5-[butyl(methyl)amino]pyrazin-2-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 109285588 |
| Molecular Formula | C20H26FN5O |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [5-[butyl(methyl)amino]pyrazin-2-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | CCCCN(C)c1cnc(C(=O)N2CCN(c3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C20H26FN5O/c1-3-4-9-24(2)19-15-22-18(14-23-19)20(27)26-12-10-25(11-13-26)17-7-5-16(21)6-8-17/h5-8,14-15H,3-4,9-13H2,1-2H3 |
| InChIKey | MKWNXNGAVYNTKA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |