C21H20FN5O — CID 109285593
(5-anilinopyrazin-2-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 109285593) has the molecular formula C21H20FN5O and a molecular weight of 377.42 g/mol. Its IUPAC name is (5-anilinopyrazin-2-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (5-anilinopyrazin-2-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 109285593 |
| Molecular Formula | C21H20FN5O |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (5-anilinopyrazin-2-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cnc(Nc2ccccc2)cn1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H20FN5O/c22-16-6-8-18(9-7-16)26-10-12-27(13-11-26)21(28)19-14-24-20(15-23-19)25-17-4-2-1-3-5-17/h1-9,14-15H,10-13H2,(H,24,25) |
| InChIKey | ZXAQNFMLORWVPM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |