C21H19F2N5O — CID 109285538
[5-(3,4-difluoroanilino)pyrazin-2-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 109285538) has the molecular formula C21H19F2N5O and a molecular weight of 395.41 g/mol. Its IUPAC name is [5-(3,4-difluoroanilino)pyrazin-2-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [5-(3,4-difluoroanilino)pyrazin-2-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109285538 |
| Molecular Formula | C21H19F2N5O |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [5-(3,4-difluoroanilino)pyrazin-2-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cnc(Nc2ccc(F)c(F)c2)cn1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H19F2N5O/c22-17-7-6-15(12-18(17)23)26-20-14-24-19(13-25-20)21(29)28-10-8-27(9-11-28)16-4-2-1-3-5-16/h1-7,12-14H,8-11H2,(H,25,26) |
| InChIKey | NJUIPKFCSHIDBY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |