C16H15F2N5O2 — CID 109278873
4-[5-(2,6-difluoroanilino)pyrazine-2-carbonyl]piperazine-1-carbaldehyde (PubChem CID 109278873) has the molecular formula C16H15F2N5O2 and a molecular weight of 347.33 g/mol. Its IUPAC name is 4-[5-(2,6-difluoroanilino)pyrazine-2-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[5-(2,6-difluoroanilino)pyrazine-2-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109278873 |
| Molecular Formula | C16H15F2N5O2 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[5-(2,6-difluoroanilino)pyrazine-2-carbonyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)c2cnc(Nc3c(F)cccc3F)cn2)CC1 |
| InChI | InChI=1S/C16H15F2N5O2/c17-11-2-1-3-12(18)15(11)21-14-9-19-13(8-20-14)16(25)23-6-4-22(10-24)5-7-23/h1-3,8-10H,4-7H2,(H,20,21) |
| InChIKey | UXBXJVGJXDJIPA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|