C17H21N5O — CID 109278481
(5-anilinopyrazin-2-yl)-(4-ethylpiperazin-1-yl)methanone (PubChem CID 109278481) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is (5-anilinopyrazin-2-yl)-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | (5-anilinopyrazin-2-yl)-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109278481 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (5-anilinopyrazin-2-yl)-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cnc(Nc3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C17H21N5O/c1-2-21-8-10-22(11-9-21)17(23)15-12-19-16(13-18-15)20-14-6-4-3-5-7-14/h3-7,12-13H,2,8-11H2,1H3,(H,19,20) |
| InChIKey | DZTXVWFIELQGOE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |