C20H18N4O — CID 109284050
(5-anilinopyrazin-2-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 109284050) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is (5-anilinopyrazin-2-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | (5-anilinopyrazin-2-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 109284050 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (5-anilinopyrazin-2-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | O=C(c1cnc(Nc2ccccc2)cn1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H18N4O/c25-20(24-11-10-15-6-4-5-7-16(15)14-24)18-12-22-19(13-21-18)23-17-8-2-1-3-9-17/h1-9,12-13H,10-11,14H2,(H,22,23) |
| InChIKey | OUDPVAZULRLIJA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |