C23H32N4O2 — CID 109196532
5-[4-(4-methoxyphenyl)piperazin-1-yl]-N,N-dipropylpyridine-2-carboxamide (PubChem CID 109196532) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 5-[4-(4-methoxyphenyl)piperazin-1-yl]-N,N-dipropylpyridine-2-carboxamide.
| Compound Name | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-N,N-dipropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109196532 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-N,N-dipropylpyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(N2CCN(c3ccc(OC)cc3)CC2)cn1 |
| InChI | InChI=1S/C23H32N4O2/c1-4-12-27(13-5-2)23(28)22-11-8-20(18-24-22)26-16-14-25(15-17-26)19-6-9-21(29-3)10-7-19/h6-11,18H,4-5,12-17H2,1-3H3 |
| InChIKey | BAKJALSRIMBYKX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|