C40H45N3O10 — CID 10919664
(2R,3S,4R,5R,6R)-5-azido-2-(hydroxymethyl)-6-[(1S,2S,3S,4S,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxyoxane-3,4-diol (PubChem CID 10919664) has the molecular formula C40H45N3O10 and a molecular weight of 727.81 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-5-azido-2-(hydroxymethyl)-6-[(1S,2S,3S,4S,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxyoxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R,6R)-5-azido-2-(hydroxymethyl)-6-[(1S,2S,3S,4S,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 10919664 |
| Molecular Formula | C40H45N3O10 |
| Molecular Weight | 727.81 g/mol |
| Exact Mass | 727.31 |
| IUPAC Name | (2R,3S,4R,5R,6R)-5-azido-2-(hydroxymethyl)-6-[(1S,2S,3S,4S,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxyoxane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@H]1[C@@H](O[C@H]2[C@@H](O)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C40H45N3O10/c41-43-42-31-33(46)32(45)30(21-44)52-40(31)53-36-34(47)35(48-22-26-13-5-1-6-14-26)37(49-23-27-15-7-2-8-16-27)39(51-25-29-19-11-4-12-20-29)38(36)50-24-28-17-9-3-10-18-28/h1-20,30-40,44-47H,21-25H2/t30-,31-,32-,33-,34+,35+,36+,37+,38-,39-,40-/m1/s1 |
| InChIKey | QDBGQNACWUSOBC-HESCYGRRSA-N |
| XLogP | 4.21 |
| TPSA | 185.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|