C17H16N2O5S — CID 1091979
N-[3-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]acetyl]phenyl]methanesulfonamide (PubChem CID 1091979) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[3-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]acetyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]acetyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 1091979 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[3-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]acetyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(C(=O)C[C@@]2(O)C(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C17H16N2O5S/c1-25(23,24)19-12-6-4-5-11(9-12)15(20)10-17(22)13-7-2-3-8-14(13)18-16(17)21/h2-9,19,22H,10H2,1H3,(H,18,21)/t17-/m0/s1 |
| InChIKey | ILVNUWYZHYHZOW-KRWDZBQOSA-N |
| XLogP | 1.47 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |