C17H15ClN2O5S — CID 40840243
N-[2-[2-[(3S)-5-chloro-3-hydroxy-2-oxo-1H-indol-3-yl]acetyl]phenyl]methanesulfonamide (PubChem CID 40840243) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is N-[2-[2-[(3S)-5-chloro-3-hydroxy-2-oxo-1H-indol-3-yl]acetyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[2-[(3S)-5-chloro-3-hydroxy-2-oxo-1H-indol-3-yl]acetyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 40840243 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-[2-[2-[(3S)-5-chloro-3-hydroxy-2-oxo-1H-indol-3-yl]acetyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)C[C@@]1(O)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H15ClN2O5S/c1-26(24,25)20-13-5-3-2-4-11(13)15(21)9-17(23)12-8-10(18)6-7-14(12)19-16(17)22/h2-8,20,23H,9H2,1H3,(H,19,22)/t17-/m0/s1 |
| InChIKey | XTIHJKZBDCLSMO-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |