C17H20N4O3S — CID 109201734
N-cyclopropyl-4-[2-(4-sulfamoylphenyl)ethylamino]pyridine-2-carboxamide (PubChem CID 109201734) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-cyclopropyl-4-[2-(4-sulfamoylphenyl)ethylamino]pyridine-2-carboxamide.
| Compound Name | N-cyclopropyl-4-[2-(4-sulfamoylphenyl)ethylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109201734 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-cyclopropyl-4-[2-(4-sulfamoylphenyl)ethylamino]pyridine-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2ccnc(C(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C17H20N4O3S/c18-25(23,24)15-5-1-12(2-6-15)7-9-19-14-8-10-20-16(11-14)17(22)21-13-3-4-13/h1-2,5-6,8,10-11,13H,3-4,7,9H2,(H,19,20)(H,21,22)(H2,18,23,24) |
| InChIKey | SYLTZSLMHFNECF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |