C16H16FN3O — CID 109201906
4-(cyclopropylamino)-N-[(4-fluorophenyl)methyl]pyridine-2-carboxamide (PubChem CID 109201906) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[(4-fluorophenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-(cyclopropylamino)-N-[(4-fluorophenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109201906 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-(cyclopropylamino)-N-[(4-fluorophenyl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cc(NC2CC2)ccn1 |
| InChI | InChI=1S/C16H16FN3O/c17-12-3-1-11(2-4-12)10-19-16(21)15-9-14(7-8-18-15)20-13-5-6-13/h1-4,7-9,13H,5-6,10H2,(H,18,20)(H,19,21) |
| InChIKey | MNZJVAGROBUKBJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |