C14H20N4O — CID 109202285
(4-methylpiperazin-1-yl)-[4-(prop-2-enylamino)-2-pyridinyl]methanone (PubChem CID 109202285) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[4-(prop-2-enylamino)-2-pyridinyl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[4-(prop-2-enylamino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109202285 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[4-(prop-2-enylamino)-2-pyridinyl]methanone |
| SMILES | C=CCNc1ccnc(C(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C14H20N4O/c1-3-5-15-12-4-6-16-13(11-12)14(19)18-9-7-17(2)8-10-18/h3-4,6,11H,1,5,7-10H2,2H3,(H,15,16) |
| InChIKey | SAIQEUNMRAXTFL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|