C19H21FN4O — CID 109202334
[4-(2-fluorophenyl)piperazin-1-yl]-[4-(prop-2-enylamino)-2-pyridinyl]methanone (PubChem CID 109202334) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-[4-(prop-2-enylamino)-2-pyridinyl]methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-[4-(prop-2-enylamino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109202334 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-[4-(prop-2-enylamino)-2-pyridinyl]methanone |
| SMILES | C=CCNc1ccnc(C(=O)N2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C19H21FN4O/c1-2-8-21-15-7-9-22-17(14-15)19(25)24-12-10-23(11-13-24)18-6-4-3-5-16(18)20/h2-7,9,14H,1,8,10-13H2,(H,21,22) |
| InChIKey | KARUZCJPUZMREN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|