C17H18F3N3O — CID 109203369
N-butan-2-yl-4-[3-(trifluoromethyl)anilino]pyridine-2-carboxamide (PubChem CID 109203369) has the molecular formula C17H18F3N3O and a molecular weight of 337.35 g/mol. Its IUPAC name is N-butan-2-yl-4-[3-(trifluoromethyl)anilino]pyridine-2-carboxamide.
| Compound Name | N-butan-2-yl-4-[3-(trifluoromethyl)anilino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109203369 |
| Molecular Formula | C17H18F3N3O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-butan-2-yl-4-[3-(trifluoromethyl)anilino]pyridine-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(Nc2cccc(C(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C17H18F3N3O/c1-3-11(2)22-16(24)15-10-14(7-8-21-15)23-13-6-4-5-12(9-13)17(18,19)20/h4-11H,3H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | XNSUHFUBWVWXSO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |