C16H16F3N3O — CID 109203420
N-butan-2-yl-4-(2,3,4-trifluoroanilino)pyridine-2-carboxamide (PubChem CID 109203420) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is N-butan-2-yl-4-(2,3,4-trifluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-butan-2-yl-4-(2,3,4-trifluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109203420 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-butan-2-yl-4-(2,3,4-trifluoroanilino)pyridine-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(Nc2ccc(F)c(F)c2F)ccn1 |
| InChI | InChI=1S/C16H16F3N3O/c1-3-9(2)21-16(23)13-8-10(6-7-20-13)22-12-5-4-11(17)14(18)15(12)19/h4-9H,3H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | VBXUASMEAKDCKN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|