C15H14F3N3O2 — CID 109205837
N-(2-methoxyethyl)-4-(2,3,4-trifluoroanilino)pyridine-2-carboxamide (PubChem CID 109205837) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(2,3,4-trifluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-(2,3,4-trifluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109205837 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-(2-methoxyethyl)-4-(2,3,4-trifluoroanilino)pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1cc(Nc2ccc(F)c(F)c2F)ccn1 |
| InChI | InChI=1S/C15H14F3N3O2/c1-23-7-6-20-15(22)12-8-9(4-5-19-12)21-11-3-2-10(16)13(17)14(11)18/h2-5,8H,6-7H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | QNHPVZSCFUPDHN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|