C17H20BrN3O2 — CID 109206175
4-(2-bromo-4-methylanilino)-N-(3-methoxypropyl)pyridine-2-carboxamide (PubChem CID 109206175) has the molecular formula C17H20BrN3O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 4-(2-bromo-4-methylanilino)-N-(3-methoxypropyl)pyridine-2-carboxamide.
| Compound Name | 4-(2-bromo-4-methylanilino)-N-(3-methoxypropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109206175 |
| Molecular Formula | C17H20BrN3O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-(2-bromo-4-methylanilino)-N-(3-methoxypropyl)pyridine-2-carboxamide |
| SMILES | COCCCNC(=O)c1cc(Nc2ccc(C)cc2Br)ccn1 |
| InChI | InChI=1S/C17H20BrN3O2/c1-12-4-5-15(14(18)10-12)21-13-6-8-19-16(11-13)17(22)20-7-3-9-23-2/h4-6,8,10-11H,3,7,9H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | UYXIXXTYFKGYMB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|