C21H30N4O — CID 109203604
4-(butan-2-ylamino)-N-[4-(diethylamino)-2-methylphenyl]pyridine-2-carboxamide (PubChem CID 109203604) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-(butan-2-ylamino)-N-[4-(diethylamino)-2-methylphenyl]pyridine-2-carboxamide.
| Compound Name | 4-(butan-2-ylamino)-N-[4-(diethylamino)-2-methylphenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109203604 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-(butan-2-ylamino)-N-[4-(diethylamino)-2-methylphenyl]pyridine-2-carboxamide |
| SMILES | CCC(C)Nc1ccnc(C(=O)Nc2ccc(N(CC)CC)cc2C)c1 |
| InChI | InChI=1S/C21H30N4O/c1-6-16(5)23-17-11-12-22-20(14-17)21(26)24-19-10-9-18(13-15(19)4)25(7-2)8-3/h9-14,16H,6-8H2,1-5H3,(H,22,23)(H,24,26) |
| InChIKey | JWHGNPVRDVMANW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|