C21H31N5O — CID 109311841
N-[4-(diethylamino)-2-methylphenyl]-2-(3-methylbutylamino)pyrimidine-4-carboxamide (PubChem CID 109311841) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-(3-methylbutylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-(3-methylbutylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109311841 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-(3-methylbutylamino)pyrimidine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccnc(NCCC(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C21H31N5O/c1-6-26(7-2)17-8-9-18(16(5)14-17)24-20(27)19-11-13-23-21(25-19)22-12-10-15(3)4/h8-9,11,13-15H,6-7,10,12H2,1-5H3,(H,24,27)(H,22,23,25) |
| InChIKey | XVRSGHDAZQNPJJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|