C22H26N6O — CID 109307014
N-[4-(diethylamino)-2-methylphenyl]-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109307014) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109307014 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccnc(NCc3ccccn3)n2)c(C)c1 |
| InChI | InChI=1S/C22H26N6O/c1-4-28(5-2)18-9-10-19(16(3)14-18)26-21(29)20-11-13-24-22(27-20)25-15-17-8-6-7-12-23-17/h6-14H,4-5,15H2,1-3H3,(H,26,29)(H,24,25,27) |
| InChIKey | HKWAVUYFSURBCU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|