C20H30N6O — CID 109301218
N-[4-(diethylamino)-2-methylphenyl]-2-[2-(dimethylamino)ethylamino]pyrimidine-4-carboxamide (PubChem CID 109301218) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-[2-(dimethylamino)ethylamino]pyrimidine-4-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-[2-(dimethylamino)ethylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109301218 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-[2-(dimethylamino)ethylamino]pyrimidine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccnc(NCCN(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C20H30N6O/c1-6-26(7-2)16-8-9-17(15(3)14-16)23-19(27)18-10-11-21-20(24-18)22-12-13-25(4)5/h8-11,14H,6-7,12-13H2,1-5H3,(H,23,27)(H,21,22,24) |
| InChIKey | ZYPJFZKFSZXQKA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|