C16H19F2N5O — CID 109301831
N-(2,4-difluorophenyl)-2-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide (PubChem CID 109301831) has the molecular formula C16H19F2N5O and a molecular weight of 335.36 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109301831 |
| Molecular Formula | C16H19F2N5O |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide |
| SMILES | CN(C)CCCNc1nccc(C(=O)Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C16H19F2N5O/c1-23(2)9-3-7-19-16-20-8-6-14(22-16)15(24)21-13-5-4-11(17)10-12(13)18/h4-6,8,10H,3,7,9H2,1-2H3,(H,21,24)(H,19,20,22) |
| InChIKey | OAKRBCQWJRQHKP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|