C18H25N5O3 — CID 109301799
N-(3,4-dimethoxyphenyl)-2-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide (PubChem CID 109301799) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109301799 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccnc(NCCCN(C)C)n2)cc1OC |
| InChI | InChI=1S/C18H25N5O3/c1-23(2)11-5-9-19-18-20-10-8-14(22-18)17(24)21-13-6-7-15(25-3)16(12-13)26-4/h6-8,10,12H,5,9,11H2,1-4H3,(H,21,24)(H,19,20,22) |
| InChIKey | MSKWGEYYTPUFQO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|