C18H16BrN5O — CID 109306996
N-(4-bromo-3-methylphenyl)-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109306996) has the molecular formula C18H16BrN5O and a molecular weight of 398.26 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109306996 |
| Molecular Formula | C18H16BrN5O |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccnc(NCc3ccccn3)n2)ccc1Br |
| InChI | InChI=1S/C18H16BrN5O/c1-12-10-13(5-6-15(12)19)23-17(25)16-7-9-21-18(24-16)22-11-14-4-2-3-8-20-14/h2-10H,11H2,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | QLHPVTOEFFJDHU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |