C20H25N3O2 — CID 109204211
4-(cyclopentylamino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide (PubChem CID 109204211) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-(cyclopentylamino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 4-(cyclopentylamino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109204211 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-(cyclopentylamino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide |
| SMILES | COc1cccc(CCNC(=O)c2cc(NC3CCCC3)ccn2)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-25-18-8-4-5-15(13-18)9-11-22-20(24)19-14-17(10-12-21-19)23-16-6-2-3-7-16/h4-5,8,10,12-14,16H,2-3,6-7,9,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | KVMLEKZMLQBUQH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |