C23H25N3O2 — CID 109214408
4-(3,5-dimethylanilino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide (PubChem CID 109214408) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-(3,5-dimethylanilino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 4-(3,5-dimethylanilino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109214408 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 4-(3,5-dimethylanilino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide |
| SMILES | COc1cccc(CCNC(=O)c2cc(Nc3cc(C)cc(C)c3)ccn2)c1 |
| InChI | InChI=1S/C23H25N3O2/c1-16-11-17(2)13-20(12-16)26-19-8-10-24-22(15-19)23(27)25-9-7-18-5-4-6-21(14-18)28-3/h4-6,8,10-15H,7,9H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | SSFCDOQSBNISIG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |