C17H21N3O4 — CID 109205966
N-(2,4-dimethoxyphenyl)-4-(2-methoxyethylamino)pyridine-2-carboxamide (PubChem CID 109205966) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(2-methoxyethylamino)pyridine-2-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(2-methoxyethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109205966 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(2-methoxyethylamino)pyridine-2-carboxamide |
| SMILES | COCCNc1ccnc(C(=O)Nc2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C17H21N3O4/c1-22-9-8-18-12-6-7-19-15(10-12)17(21)20-14-5-4-13(23-2)11-16(14)24-3/h4-7,10-11H,8-9H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | WZSNOPYDLJQYPK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|