C14H18N4O3 — CID 109206386
4-(3-methoxypropylamino)-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2-carboxamide (PubChem CID 109206386) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-(3-methoxypropylamino)-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2-carboxamide.
| Compound Name | 4-(3-methoxypropylamino)-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109206386 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-(3-methoxypropylamino)-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2-carboxamide |
| SMILES | COCCCNc1ccnc(C(=O)Nc2cc(C)on2)c1 |
| InChI | InChI=1S/C14H18N4O3/c1-10-8-13(18-21-10)17-14(19)12-9-11(4-6-16-12)15-5-3-7-20-2/h4,6,8-9H,3,5,7H2,1-2H3,(H,15,16)(H,17,18,19) |
| InChIKey | SSJRWWLSGBZKRC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|