C15H18N4O4 — CID 109082638
4-N-(3-methoxypropyl)-2-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2,4-dicarboxamide (PubChem CID 109082638) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-N-(3-methoxypropyl)-2-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(3-methoxypropyl)-2-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082638 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 4-N-(3-methoxypropyl)-2-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1ccnc(C(=O)Nc2cc(C)on2)c1 |
| InChI | InChI=1S/C15H18N4O4/c1-10-8-13(19-23-10)18-15(21)12-9-11(4-6-16-12)14(20)17-5-3-7-22-2/h4,6,8-9H,3,5,7H2,1-2H3,(H,17,20)(H,18,19,21) |
| InChIKey | MQXNUPBYTBDDAH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|