C18H18ClN3O4 — CID 109206683
methyl 4-chloro-3-[(4-morpholin-4-ylpyridine-2-carbonyl)amino]benzoate (PubChem CID 109206683) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is methyl 4-chloro-3-[(4-morpholin-4-ylpyridine-2-carbonyl)amino]benzoate.
| Compound Name | methyl 4-chloro-3-[(4-morpholin-4-ylpyridine-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 109206683 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | methyl 4-chloro-3-[(4-morpholin-4-ylpyridine-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)c2cc(N3CCOCC3)ccn2)c1 |
| InChI | InChI=1S/C18H18ClN3O4/c1-25-18(24)12-2-3-14(19)15(10-12)21-17(23)16-11-13(4-5-20-16)22-6-8-26-9-7-22/h2-5,10-11H,6-9H2,1H3,(H,21,23) |
| InChIKey | MTEQQQKLCIQLQK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |