C17H17ClN4O4 — CID 109300469
methyl 4-chloro-3-[(2-morpholin-4-ylpyrimidine-4-carbonyl)amino]benzoate (PubChem CID 109300469) has the molecular formula C17H17ClN4O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is methyl 4-chloro-3-[(2-morpholin-4-ylpyrimidine-4-carbonyl)amino]benzoate.
| Compound Name | methyl 4-chloro-3-[(2-morpholin-4-ylpyrimidine-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 109300469 |
| Molecular Formula | C17H17ClN4O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | methyl 4-chloro-3-[(2-morpholin-4-ylpyrimidine-4-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)c2ccnc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C17H17ClN4O4/c1-25-16(24)11-2-3-12(18)14(10-11)20-15(23)13-4-5-19-17(21-13)22-6-8-26-9-7-22/h2-5,10H,6-9H2,1H3,(H,20,23) |
| InChIKey | XUDPNTJDMFERST-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |