C11H17N5O3 — CID 87482379
N'-methoxy-N'-methyl-2-morpholin-4-ylpyrimidine-4-carbohydrazide (PubChem CID 87482379) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is N'-methoxy-N'-methyl-2-morpholin-4-ylpyrimidine-4-carbohydrazide.
| Compound Name | N'-methoxy-N'-methyl-2-morpholin-4-ylpyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 87482379 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N'-methoxy-N'-methyl-2-morpholin-4-ylpyrimidine-4-carbohydrazide |
| SMILES | CON(C)NC(=O)c1ccnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H17N5O3/c1-15(18-2)14-10(17)9-3-4-12-11(13-9)16-5-7-19-8-6-16/h3-4H,5-8H2,1-2H3,(H,14,17) |
| InChIKey | BPVSWTKYLPBPEV-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|