C17H13F2N3O2 — CID 109209444
4-(3,4-difluoroanilino)-N-(furan-2-ylmethyl)pyridine-2-carboxamide (PubChem CID 109209444) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 4-(3,4-difluoroanilino)-N-(furan-2-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 4-(3,4-difluoroanilino)-N-(furan-2-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109209444 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-(3,4-difluoroanilino)-N-(furan-2-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cc(Nc2ccc(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-14-4-3-11(8-15(14)19)22-12-5-6-20-16(9-12)17(23)21-10-13-2-1-7-24-13/h1-9H,10H2,(H,20,22)(H,21,23) |
| InChIKey | VFPKINPFDIIYDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |