C17H14ClFN4O2 — CID 109368165
6-(3-chloro-4-fluoroanilino)-N-(furan-2-ylmethyl)-2-methylpyrimidine-4-carboxamide (PubChem CID 109368165) has the molecular formula C17H14ClFN4O2 and a molecular weight of 360.78 g/mol. Its IUPAC name is 6-(3-chloro-4-fluoroanilino)-N-(furan-2-ylmethyl)-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-(3-chloro-4-fluoroanilino)-N-(furan-2-ylmethyl)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109368165 |
| Molecular Formula | C17H14ClFN4O2 |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 6-(3-chloro-4-fluoroanilino)-N-(furan-2-ylmethyl)-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(Nc2ccc(F)c(Cl)c2)cc(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C17H14ClFN4O2/c1-10-21-15(17(24)20-9-12-3-2-6-25-12)8-16(22-10)23-11-4-5-14(19)13(18)7-11/h2-8H,9H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | YPAPGBGPMNBONH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |