C16H19ClFN5O — CID 109366264
6-(3-chloro-4-fluoroanilino)-N-[2-(dimethylamino)ethyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 109366264) has the molecular formula C16H19ClFN5O and a molecular weight of 351.81 g/mol. Its IUPAC name is 6-(3-chloro-4-fluoroanilino)-N-[2-(dimethylamino)ethyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-(3-chloro-4-fluoroanilino)-N-[2-(dimethylamino)ethyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109366264 |
| Molecular Formula | C16H19ClFN5O |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-(3-chloro-4-fluoroanilino)-N-[2-(dimethylamino)ethyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(Nc2ccc(F)c(Cl)c2)cc(C(=O)NCCN(C)C)n1 |
| InChI | InChI=1S/C16H19ClFN5O/c1-10-20-14(16(24)19-6-7-23(2)3)9-15(21-10)22-11-4-5-13(18)12(17)8-11/h4-5,8-9H,6-7H2,1-3H3,(H,19,24)(H,20,21,22) |
| InChIKey | PBXBBJZLJKXTRN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |