C6H10O6 — CID 10921067
(3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanal (PubChem CID 10921067) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is (3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanal.
| Compound Name | (3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanal |
|---|---|
| PubChem CID | 10921067 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanal |
| SMILES | O=CC(=O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,4-6,8,10-12H,2H2/t4-,5+,6+/m0/s1 |
| InChIKey | DCNMIDLYWOTSGK-KVQBGUIXSA-N |
| XLogP | -3.17 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|