C23H24FN3O — CID 109214186
4-[2-(4-fluorophenyl)ethylamino]-N-(3-phenylpropyl)pyridine-2-carboxamide (PubChem CID 109214186) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethylamino]-N-(3-phenylpropyl)pyridine-2-carboxamide.
| Compound Name | 4-[2-(4-fluorophenyl)ethylamino]-N-(3-phenylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109214186 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethylamino]-N-(3-phenylpropyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cc(NCCc2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C23H24FN3O/c24-20-10-8-19(9-11-20)12-15-25-21-13-16-26-22(17-21)23(28)27-14-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-11,13,16-17H,4,7,12,14-15H2,(H,25,26)(H,27,28) |
| InChIKey | DUQLHYLICLSULI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|