C22H21ClFN3O — CID 109214119
4-[2-(3-chlorophenyl)ethylamino]-N-[2-(4-fluorophenyl)ethyl]pyridine-2-carboxamide (PubChem CID 109214119) has the molecular formula C22H21ClFN3O and a molecular weight of 397.88 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)ethylamino]-N-[2-(4-fluorophenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 4-[2-(3-chlorophenyl)ethylamino]-N-[2-(4-fluorophenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109214119 |
| Molecular Formula | C22H21ClFN3O |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-[2-(3-chlorophenyl)ethylamino]-N-[2-(4-fluorophenyl)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1cc(NCCc2cccc(Cl)c2)ccn1 |
| InChI | InChI=1S/C22H21ClFN3O/c23-18-3-1-2-17(14-18)9-11-25-20-10-13-26-21(15-20)22(28)27-12-8-16-4-6-19(24)7-5-16/h1-7,10,13-15H,8-9,11-12H2,(H,25,26)(H,27,28) |
| InChIKey | DFVGRHFOUMQWOI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |