C22H22FN3O — CID 109210175
4-[2-(4-fluorophenyl)ethylamino]-N-[(3-methylphenyl)methyl]pyridine-2-carboxamide (PubChem CID 109210175) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethylamino]-N-[(3-methylphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-[2-(4-fluorophenyl)ethylamino]-N-[(3-methylphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109210175 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethylamino]-N-[(3-methylphenyl)methyl]pyridine-2-carboxamide |
| SMILES | Cc1cccc(CNC(=O)c2cc(NCCc3ccc(F)cc3)ccn2)c1 |
| InChI | InChI=1S/C22H22FN3O/c1-16-3-2-4-18(13-16)15-26-22(27)21-14-20(10-12-25-21)24-11-9-17-5-7-19(23)8-6-17/h2-8,10,12-14H,9,11,15H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | NJJCJIMUBOEEEB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |